cas: 56469-10-4 — see every product listed under this CAS number, including other names
5-(2-Methyloctan-2-yl)benzene-1,3-diol 98% (CAS 56469-10-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A117978-250mg |
| cas | 56469-10-4 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 175.69 Pln | |
| Ambeed | 1g | 225.75 Pln | |
| Ambeed | 5g | 409.31 Pln | |
| Ambeed | 10g | 726.38 Pln | |
| Ambeed | 25g | 1427.25 Pln | |
| Ambeed | 100g | 5204.19 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A117978 |
5-(2-methyloctan-2-yl)benzene-1,3-diol (CAS 56469-10-4) is a chemical compound with the molecular formula C15H24O2 and a molecular weight of 236.35 g/mol. IUPAC name: 5-(2-methyloctan-2-yl)benzene-1,3-diol. InChIKey: GWBGUJWRDDDVBI-UHFFFAOYSA-N.
| Molecular formula | C15H24O2 |
|---|---|
| Molecular weight | 236.35 g/mol |
| IUPAC name | 5-(2-methyloctan-2-yl)benzene-1,3-diol |
| InChIKey | GWBGUJWRDDDVBI-UHFFFAOYSA-N |
| SMILES | CCCCCCC(C)(C)C1=CC(=CC(=C1)O)O |
Computed by PubChem (NCBI)