cas: 1403469-16-8 — see every product listed under this CAS number, including other names
5-(3-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl)oxazole, 95%, 95% (CAS 1403469-16-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch131LP1-100mg |
| cas | 1403469-16-8 |
| size | 100mg |
| availability | 6g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 650.00 Pln | |
| Chemat | 250mg | 1062.80 Pln | |
| Chemat | 1g | 2661.20 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
5-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1,3-oxazole (CAS 1403469-16-8) is a chemical compound with the molecular formula C15H18BNO3 and a molecular weight of 271.12 g/mol. IUPAC name: 5-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1,3-oxazole. InChIKey: ARCSVGVKEQMHMC-UHFFFAOYSA-N.
| Molecular formula | C15H18BNO3 |
|---|---|
| Molecular weight | 271.12 g/mol |
| IUPAC name | 5-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1,3-oxazole |
| InChIKey | ARCSVGVKEQMHMC-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CC=C2)C3=CN=CO3 |
Computed by PubChem (NCBI)