CAS 374715-22-7 is the registry number for 3-Phenyl-isoxazole-5-boronic acid pinacol ester, 95%. Offered by: Combi-blocks. Available pack sizes: 100mg, 1g, 250mg.
3-phenyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,2-oxazole (CAS 374715-22-7) is a chemical compound with the molecular formula C15H18BNO3 and a molecular weight of 271.12 g/mol. IUPAC name: 3-phenyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,2-oxazole. InChIKey: ZFUDBXAMQSUYAQ-UHFFFAOYSA-N.
| Molecular formula | C15H18BNO3 |
|---|---|
| Molecular weight | 271.12 g/mol |
| IUPAC name | 3-phenyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,2-oxazole |
| InChIKey | ZFUDBXAMQSUYAQ-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=NO2)C3=CC=CC=C3 |
Computed by PubChem (NCBI)