Products 2096333-60-5

CAS 2096333-60-5 is the registry number for 6-(2-t-Butylphenoxy)pyridine-3-boronic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 1g.

Structural formula: {0} (CAS {1})

[6-(2-tert-butylphenoxy)-3-pyridinyl]boronic acid (CAS 2096333-60-5) is a chemical compound with the molecular formula C15H18BNO3 and a molecular weight of 271.12 g/mol. IUPAC name: [6-(2-tert-butylphenoxy)-3-pyridinyl]boronic acid. InChIKey: AUPGMPCNGWLXGK-UHFFFAOYSA-N.

Identity
Molecular formulaC15H18BNO3
Molecular weight271.12 g/mol
IUPAC name[6-(2-tert-butylphenoxy)-3-pyridinyl]boronic acid
InChIKeyAUPGMPCNGWLXGK-UHFFFAOYSA-N
SMILESB(C1=CN=C(C=C1)OC2=CC=CC=C2C(C)(C)C)(O)O

Computed by PubChem (NCBI)