cas: 1207623-97-9 — see every product listed under this CAS number, including other names
5-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrrolo[2,3-b]pyridin-2(3H)-one 97% (CAS 1207623-97-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A246639-100mg |
| cas | 1207623-97-9 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 537.25 Pln | |
| Ambeed | 250mg | 693.00 Pln | |
| Ambeed | 1g | 1338.25 Pln | |
| Ambeed | 5g | 6005.19 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A246639 |
5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-dihydropyrrolo[2,3-b]pyridin-2-one (CAS 1207623-97-9) is a chemical compound with the molecular formula C13H17BN2O3 and a molecular weight of 260.10 g/mol. IUPAC name: 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-dihydropyrrolo[2,3-b]pyridin-2-one. InChIKey: SQTORENJRGJAKX-UHFFFAOYSA-N.
| Molecular formula | C13H17BN2O3 |
|---|---|
| Molecular weight | 260.10 g/mol |
| IUPAC name | 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-dihydropyrrolo[2,3-b]pyridin-2-one |
| InChIKey | SQTORENJRGJAKX-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC3=C(NC(=O)C3)N=C2 |
Computed by PubChem (NCBI)