cas: 1207623-97-9 — see every product listed under this CAS number, including other names
5-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrrolo[2,3-b]pyridin-2(3H)-one, 95%, 95% (CAS 1207623-97-9) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1106ON-50mg |
| cas | 1207623-97-9 |
| size | 50mg |
| availability | 4g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 50mg | 160.40 Pln | |
| Chemat | 100mg | 232.40 Pln | |
| Chemat | 250mg | 357.20 Pln | |
| Chemat | 1g | 1211.60 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-dihydropyrrolo[2,3-b]pyridin-2-one (CAS 1207623-97-9) is a chemical compound with the molecular formula C13H17BN2O3 and a molecular weight of 260.10 g/mol. IUPAC name: 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-dihydropyrrolo[2,3-b]pyridin-2-one. InChIKey: SQTORENJRGJAKX-UHFFFAOYSA-N.
| Molecular formula | C13H17BN2O3 |
|---|---|
| Molecular weight | 260.10 g/mol |
| IUPAC name | 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-dihydropyrrolo[2,3-b]pyridin-2-one |
| InChIKey | SQTORENJRGJAKX-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC3=C(NC(=O)C3)N=C2 |
Computed by PubChem (NCBI)