CAS 2223039-64-1 is the registry number for 1–(5–(4,4,5,5–Tetramethyl–1,3,2–dioxaborolan–2–yl)furan–3–yl)–1H–pyrazole. Offered by: GLPBio. Available pack sizes: 100mg, 25mg.
1-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)furan-3-yl]pyrazole (CAS 2223039-64-1) is a chemical compound with the molecular formula C13H17BN2O3 and a molecular weight of 260.10 g/mol. IUPAC name: 1-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)furan-3-yl]pyrazole. InChIKey: KWHSMUXVHAMJEN-UHFFFAOYSA-N.
| Molecular formula | C13H17BN2O3 |
|---|---|
| Molecular weight | 260.10 g/mol |
| IUPAC name | 1-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)furan-3-yl]pyrazole |
| InChIKey | KWHSMUXVHAMJEN-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CO2)N3C=CC=N3 |
Computed by PubChem (NCBI)