cas: 942070-84-0 — see every product listed under this CAS number, including other names
5-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)oxazole 96% (CAS 942070-84-0) is a chemical reagent available from Chemat. Available pack sizes: 5g, 50mg, 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A356896-5g |
| cas | 942070-84-0 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 5g | 16829.81 Pln | |
| Ambeed | 50mg | 987.81 Pln | |
| Ambeed | 100mg | 1171.38 Pln | |
| Ambeed | 250mg | 1744.31 Pln | |
| Ambeed | 1g | 4258.56 Pln |
| purity | 96% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A356896 |
5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-oxazole (CAS 942070-84-0) is a chemical compound with the molecular formula C9H14BNO3 and a molecular weight of 195.03 g/mol. IUPAC name: 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-oxazole. InChIKey: VKDRZPADYMLKNW-UHFFFAOYSA-N.
| Molecular formula | C9H14BNO3 |
|---|---|
| Molecular weight | 195.03 g/mol |
| IUPAC name | 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-oxazole |
| InChIKey | VKDRZPADYMLKNW-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CN=CO2 |
Computed by PubChem (NCBI)