cas: 942070-84-0 — see every product listed under this CAS number, including other names
5-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)oxazole, 98%, 98% (CAS 942070-84-0) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 500mg, 1g, 5g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11H21W-50mg |
| cas | 942070-84-0 |
| size | 50mg |
| availability | 25g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 50mg | 338.00 Pln | |
| Chemat | 100mg | 477.20 Pln | |
| Chemat | 250mg | 750.80 Pln | |
| Chemat | 500mg | 1096.40 Pln | |
| Chemat | 1g | 1576.40 Pln | |
| Chemat | 5g | 5435.60 Pln | |
| Chemat | 25g | 16298.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-oxazole (CAS 942070-84-0) is a chemical compound with the molecular formula C9H14BNO3 and a molecular weight of 195.03 g/mol. IUPAC name: 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-oxazole. InChIKey: VKDRZPADYMLKNW-UHFFFAOYSA-N.
| Molecular formula | C9H14BNO3 |
|---|---|
| Molecular weight | 195.03 g/mol |
| IUPAC name | 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-oxazole |
| InChIKey | VKDRZPADYMLKNW-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CN=CO2 |
Computed by PubChem (NCBI)