cas: 402960-38-7 — see every product listed under this CAS number, including other names
5-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-amine 98% (CAS 402960-38-7) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g, 100g, 500g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A117488-5g |
| cas | 402960-38-7 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 5g | 203.50 Pln | |
| Ambeed | 10g | 281.38 Pln | |
| Ambeed | 25g | 515.00 Pln | |
| Ambeed | 100g | 1560.75 Pln | |
| Ambeed | 500g | 6522.50 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A117488 |
5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-amine (CAS 402960-38-7) is a chemical compound with the molecular formula C10H16BN3O2 and a molecular weight of 221.07 g/mol. IUPAC name: 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-amine. InChIKey: BPQVMIDUTRJYSC-UHFFFAOYSA-N.
| Molecular formula | C10H16BN3O2 |
|---|---|
| Molecular weight | 221.07 g/mol |
| IUPAC name | 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-amine |
| InChIKey | BPQVMIDUTRJYSC-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CN=C(N=C2)N |
Computed by PubChem (NCBI)