CAS 402960-38-7 appears in our catalog under these names: 2-Aminopyrimidine-5-boronic acid, pinacol ester, 98%, 2-Aminopyrimidine-5-boronic Acid Pinacol Ester, 2–Aminopyrimidine–5–boronic acid pinacol ester, 2-Amino-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidine, >98.0%(GC)(T), 5-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-amine 98%. Offered by: Combi-blocks, TRC, GLPBio, Biosynth, TCI. Available pack sizes: 25g, 5g, 100g, 1g, 500mg, 10g, 50g, 500g.
5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-amine (CAS 402960-38-7) is a chemical compound with the molecular formula C10H16BN3O2 and a molecular weight of 221.07 g/mol. IUPAC name: 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-amine. InChIKey: BPQVMIDUTRJYSC-UHFFFAOYSA-N.
| Molecular formula | C10H16BN3O2 |
|---|---|
| Molecular weight | 221.07 g/mol |
| IUPAC name | 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-amine |
| InChIKey | BPQVMIDUTRJYSC-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CN=C(N=C2)N |
Computed by PubChem (NCBI)