CAS 1251566-81-0 is the registry number for 6-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-4-amine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-4-amine (CAS 1251566-81-0) is a chemical compound with the molecular formula C10H16BN3O2 and a molecular weight of 221.07 g/mol. IUPAC name: 6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-4-amine. InChIKey: YPHRKNBDXMSXAO-UHFFFAOYSA-N.
| Molecular formula | C10H16BN3O2 |
|---|---|
| Molecular weight | 221.07 g/mol |
| IUPAC name | 6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-4-amine |
| InChIKey | YPHRKNBDXMSXAO-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=NC=N2)N |
Computed by PubChem (NCBI)