cas: 1086111-09-2 — see every product listed under this CAS number, including other names
5-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)thiazole, 97%, 97% (CAS 1086111-09-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 50g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1146OP-100mg |
| cas | 1086111-09-2 |
| size | 100mg |
| availability | 163.46g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 83.60 Pln | |
| Chemat | 250mg | 93.20 Pln | |
| Chemat | 1g | 131.60 Pln | |
| Chemat | 5g | 275.60 Pln | |
| Chemat | 10g | 482.00 Pln | |
| Chemat | 25g | 1096.40 Pln | |
| Chemat | 50g | 1994.00 Pln | |
| Chemat | 100g | 3851.60 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-thiazole (CAS 1086111-09-2) is a chemical compound with the molecular formula C9H14BNO2S and a molecular weight of 211.09 g/mol. IUPAC name: 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-thiazole. InChIKey: ODYWLZYOVWNCGN-UHFFFAOYSA-N.
| Molecular formula | C9H14BNO2S |
|---|---|
| Molecular weight | 211.09 g/mol |
| IUPAC name | 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-thiazole |
| InChIKey | ODYWLZYOVWNCGN-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CN=CS2 |
Computed by PubChem (NCBI)