cas: 779335-05-6 — see every product listed under this CAS number, including other names
5-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)thiophene-2-carboxylic acid, 98% (CAS 779335-05-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F319767-250MG |
| cas | 779335-05-6 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 206.20 Pln | |
| Fluorochem | 1g | 424.87 Pln | |
| Fluorochem | 5g | 1455.76 Pln | |
| Fluorochem | 10g | 2856.30 Pln | |
| Fluorochem | 25g | 6516.47 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)thiophene-2-carboxylic acid (CAS 779335-05-6) is a chemical compound with the molecular formula C11H15BO4S and a molecular weight of 254.11 g/mol. IUPAC name: 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)thiophene-2-carboxylic acid. InChIKey: YLZRZHOUXZZBTF-UHFFFAOYSA-N.
| Molecular formula | C11H15BO4S |
|---|---|
| Molecular weight | 254.11 g/mol |
| IUPAC name | 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)thiophene-2-carboxylic acid |
| InChIKey | YLZRZHOUXZZBTF-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(S2)C(=O)O |
Computed by PubChem (NCBI)