cas: 1062174-44-0 — see every product listed under this CAS number, including other names
5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indoline, 98%, 98% (CAS 1062174-44-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch118DHN-100mg |
| cas | 1062174-44-0 |
| size | 100mg |
| availability | 15g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 170.00 Pln | |
| Chemat | 250mg | 246.80 Pln | |
| Chemat | 1g | 530.00 Pln | |
| Chemat | 5g | 2123.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2,3-dihydro-1H-indole (CAS 1062174-44-0) is a chemical compound with the molecular formula C14H20BNO2 and a molecular weight of 245.13 g/mol. IUPAC name: 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2,3-dihydro-1H-indole. InChIKey: ZYOHYGQNRQMVMG-UHFFFAOYSA-N.
| Molecular formula | C14H20BNO2 |
|---|---|
| Molecular weight | 245.13 g/mol |
| IUPAC name | 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2,3-dihydro-1H-indole |
| InChIKey | ZYOHYGQNRQMVMG-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC3=C(C=C2)NCC3 |
Computed by PubChem (NCBI)