CAS 1879959-77-9 is the registry number for 7-(Tetramethyl-1,3,2-dioxaborolan-2-yl)-2,3-dihydro-1h-indole, 95%. Offered by: Combi-blocks, AmBeed, Fluorochem. Available pack sizes: 250mg, 100mg, 1g.
7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2,3-dihydro-1H-indole (CAS 1879959-77-9) is a chemical compound with the molecular formula C14H20BNO2 and a molecular weight of 245.13 g/mol. IUPAC name: 7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2,3-dihydro-1H-indole. InChIKey: LLYWNYSNVJPKHA-UHFFFAOYSA-N.
| Molecular formula | C14H20BNO2 |
|---|---|
| Molecular weight | 245.13 g/mol |
| IUPAC name | 7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2,3-dihydro-1H-indole |
| InChIKey | LLYWNYSNVJPKHA-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C3C(=CC=C2)CCN3 |
Computed by PubChem (NCBI)