CAS 1491162-09-4 is the registry number for 5-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)isoindoline, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2,3-dihydro-1H-isoindole (CAS 1491162-09-4) is a chemical compound with the molecular formula C14H20BNO2 and a molecular weight of 245.13 g/mol. IUPAC name: 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2,3-dihydro-1H-isoindole. InChIKey: PYNZSPXHQFJJOJ-UHFFFAOYSA-N.
| Molecular formula | C14H20BNO2 |
|---|---|
| Molecular weight | 245.13 g/mol |
| IUPAC name | 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2,3-dihydro-1H-isoindole |
| InChIKey | PYNZSPXHQFJJOJ-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC3=C(CNC3)C=C2 |
Computed by PubChem (NCBI)