CAS 51659-90-6 is the registry number for 5-(4-Aminophenyl)-1,3,4-thiadiazol-2-amine, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
5-(4-aminophenyl)-1,3,4-thiadiazol-2-amine (CAS 51659-90-6) is a chemical compound with the molecular formula C8H8N4S and a molecular weight of 192.24 g/mol. IUPAC name: 5-(4-aminophenyl)-1,3,4-thiadiazol-2-amine. InChIKey: YYMNNMPOIWBZRJ-UHFFFAOYSA-N.
| Molecular formula | C8H8N4S |
|---|---|
| Molecular weight | 192.24 g/mol |
| IUPAC name | 5-(4-aminophenyl)-1,3,4-thiadiazol-2-amine |
| InChIKey | YYMNNMPOIWBZRJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=NN=C(S2)N)N |
Computed by PubChem (NCBI)