CAS 17418-21-2 is the registry number for 5-Amino-2-phenyl-2,4-dihydro-3h-1,2,4-triazole-3-thione, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
5-amino-2-phenyl-1H-1,2,4-triazole-3-thione (CAS 17418-21-2) is a chemical compound with the molecular formula C8H8N4S and a molecular weight of 192.24 g/mol. IUPAC name: 5-amino-2-phenyl-1H-1,2,4-triazole-3-thione. InChIKey: LGTVZBMFUQZSDK-UHFFFAOYSA-N.
| Molecular formula | C8H8N4S |
|---|---|
| Molecular weight | 192.24 g/mol |
| IUPAC name | 5-amino-2-phenyl-1H-1,2,4-triazole-3-thione |
| InChIKey | LGTVZBMFUQZSDK-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)N2C(=S)N=C(N2)N |
Computed by PubChem (NCBI)