CAS 1033693-08-1 is the registry number for (2-Pyrazin-2-yl-1,3-thiazol-4-yl)methylamine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
(2-pyrazin-2-yl-1,3-thiazol-4-yl)methanamine (CAS 1033693-08-1) is a chemical compound with the molecular formula C8H8N4S and a molecular weight of 192.24 g/mol. IUPAC name: (2-pyrazin-2-yl-1,3-thiazol-4-yl)methanamine. InChIKey: HHHJBCALZJNSBZ-UHFFFAOYSA-N.
| Molecular formula | C8H8N4S |
|---|---|
| Molecular weight | 192.24 g/mol |
| IUPAC name | (2-pyrazin-2-yl-1,3-thiazol-4-yl)methanamine |
| InChIKey | HHHJBCALZJNSBZ-UHFFFAOYSA-N |
| SMILES | C1=CN=C(C=N1)C2=NC(=CS2)CN |
Computed by PubChem (NCBI)