cas: 35333-26-7 — see every product listed under this CAS number, including other names
5-(4-Bromophenyl)-5-oxovaleric acid, 97% (CAS 35333-26-7) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 250mg, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F207079-50MG |
| cas | 35333-26-7 |
| size | 50mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 50mg | 247.85 Pln | |
| Fluorochem | 250mg | 627.92 Pln | |
| Fluorochem | 5g | 4288.09 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
5-(4-bromophenyl)-5-oxopentanoic acid (CAS 35333-26-7) is a chemical compound with the molecular formula C11H11BrO3 and a molecular weight of 271.11 g/mol. IUPAC name: 5-(4-bromophenyl)-5-oxopentanoic acid. InChIKey: YWKKQTFYOQBCBE-UHFFFAOYSA-N.
| Molecular formula | C11H11BrO3 |
|---|---|
| Molecular weight | 271.11 g/mol |
| IUPAC name | 5-(4-bromophenyl)-5-oxopentanoic acid |
| InChIKey | YWKKQTFYOQBCBE-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)CCCC(=O)O)Br |
Computed by PubChem (NCBI)