CAS 35970-34-4 appears in our catalog under these names: 2-Bromo-1-(3,4-dihydro-2h-1,5-benzodioxepin-7-yl)ethan-1-one, 95%, 2-Bromo-1-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)ethan-1-one. Offered by: Combi-blocks, Biosynth, Chemat. Available pack sizes: 5g, 1g, 10g, 250mg.
2-bromo-1-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)ethanone (CAS 35970-34-4) is a chemical compound with the molecular formula C11H11BrO3 and a molecular weight of 271.11 g/mol. IUPAC name: 2-bromo-1-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)ethanone. InChIKey: YJSZSLGVTLSCRU-UHFFFAOYSA-N.
| Molecular formula | C11H11BrO3 |
|---|---|
| Molecular weight | 271.11 g/mol |
| IUPAC name | 2-bromo-1-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)ethanone |
| InChIKey | YJSZSLGVTLSCRU-UHFFFAOYSA-N |
| SMILES | C1COC2=C(C=C(C=C2)C(=O)CBr)OC1 |
Computed by PubChem (NCBI)