Products 35333-26-7
CAS 35333-26-7 appears in our catalog under these names: 5-(4-Bromophenyl)-5-oxopentanoic acid, 97%, 5-(4-Bromophenyl)-5-oxovaleric acid, 5-(4-Bromophenyl)-5-oxopentanoic acid, 97%, 97%, 5-(4-Bromophenyl)-5-oxovaleric acid, 97%. Offered by: Combi-blocks, AmBeed, Biosynth, Chemat, Fluorochem. Available pack sizes: 250mg, 10g, 5g, 25g, 1g, 0,5g, 50mg.
5-(4-bromophenyl)-5-oxopentanoic acid (CAS 35333-26-7) is a chemical compound with the molecular formula C11H11BrO3 and a molecular weight of 271.11 g/mol. IUPAC name: 5-(4-bromophenyl)-5-oxopentanoic acid. InChIKey: YWKKQTFYOQBCBE-UHFFFAOYSA-N.
| Molecular formula | C11H11BrO3 |
|---|---|
| Molecular weight | 271.11 g/mol |
| IUPAC name | 5-(4-bromophenyl)-5-oxopentanoic acid |
| InChIKey | YWKKQTFYOQBCBE-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)CCCC(=O)O)Br |
Computed by PubChem (NCBI)