5-(4-Fluorophenyl)-1,3,4-thiadiazole-2-carboxylic acid, 98%
cas: 1260672-44-3 — see every product listed under this CAS number, including other names
5-(4-Fluorophenyl)-1,3,4-thiadiazole-2-carboxylic acid, 98% (CAS 1260672-44-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 50mg. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A1274463-100mg |
| cas | 1260672-44-3 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 615.13 Pln | |
| Ambeed | 250mg | 1021.19 Pln | |
| Ambeed | 1g | 2634.31 Pln | |
| Chemat | 50mg | 386.00 Pln | |
| Chemat | 100mg | 611.60 Pln | |
| Chemat | 250mg | 995.60 Pln | |
| Chemat | 1g | 2579.60 Pln | |
| BLDpharm | 50mg | 430.98 Pln | |
| BLDpharm | 100mg | 658.68 Pln | |
| BLDpharm | 250mg | 1097.42 Pln | |
| BLDpharm | 1g | 2835.69 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
5-(4-fluorophenyl)-1,3,4-thiadiazole-2-carboxylic acid (CAS 1260672-44-3) is a chemical compound with the molecular formula C9H5FN2O2S and a molecular weight of 224.21 g/mol. IUPAC name: 5-(4-fluorophenyl)-1,3,4-thiadiazole-2-carboxylic acid. InChIKey: REUPNRSSQGDMSI-UHFFFAOYSA-N.
| Molecular formula | C9H5FN2O2S |
|---|---|
| Molecular weight | 224.21 g/mol |
| IUPAC name | 5-(4-fluorophenyl)-1,3,4-thiadiazole-2-carboxylic acid |
| InChIKey | REUPNRSSQGDMSI-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=NN=C(S2)C(=O)O)F |
Computed by PubChem (NCBI)