Products 1427380-08-2
CAS 1427380-08-2 appears in our catalog under these names: 2-(3-Fluoropyridin-2-yl)-1,3-thiazole-4-carboxylic acid, 2-(3-Fluoropyridin-2-yl)-1,3-thiazole-4-carboxylic acid, 95%. Offered by: Biosynth, AmBeed. Available pack sizes: 50mg, 0,5g, 1g.
2-(3-fluoro-2-pyridinyl)-1,3-thiazole-4-carboxylic acid (CAS 1427380-08-2) is a chemical compound with the molecular formula C9H5FN2O2S and a molecular weight of 224.21 g/mol. IUPAC name: 2-(3-fluoro-2-pyridinyl)-1,3-thiazole-4-carboxylic acid. InChIKey: KNLXDRWBMCSBJL-UHFFFAOYSA-N.
| Molecular formula | C9H5FN2O2S |
|---|---|
| Molecular weight | 224.21 g/mol |
| IUPAC name | 2-(3-fluoro-2-pyridinyl)-1,3-thiazole-4-carboxylic acid |
| InChIKey | KNLXDRWBMCSBJL-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(N=C1)C2=NC(=CS2)C(=O)O)F |
Computed by PubChem (NCBI)