Products 1260672-44-3
CAS 1260672-44-3 is the registry number for 5-(4-Fluorophenyl)-1,3,4-thiadiazole-2-carboxylic acid, 98%. Offered by: Ambeed, Chemat, BLDpharm. Available pack sizes: 100mg, 250mg, 1g, 50mg.
5-(4-fluorophenyl)-1,3,4-thiadiazole-2-carboxylic acid (CAS 1260672-44-3) is a chemical compound with the molecular formula C9H5FN2O2S and a molecular weight of 224.21 g/mol. IUPAC name: 5-(4-fluorophenyl)-1,3,4-thiadiazole-2-carboxylic acid. InChIKey: REUPNRSSQGDMSI-UHFFFAOYSA-N.
| Molecular formula | C9H5FN2O2S |
|---|---|
| Molecular weight | 224.21 g/mol |
| IUPAC name | 5-(4-fluorophenyl)-1,3,4-thiadiazole-2-carboxylic acid |
| InChIKey | REUPNRSSQGDMSI-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=NN=C(S2)C(=O)O)F |
Computed by PubChem (NCBI)