cas: 29527-27-3 — see every product listed under this CAS number, including other names
5-(4-chlorophenyl)-4-methyl-4H-1,2,4-triazole-3-thiol (CAS 29527-27-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F365700-250MG |
| cas | 29527-27-3 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 1190.22 Pln | |
| Fluorochem | 1g | 1299.56 Pln |
| delivery time | 2-3 weeks |
|---|
3-(4-chlorophenyl)-4-methyl-1H-1,2,4-triazole-5-thione (CAS 29527-27-3) is a chemical compound with the molecular formula C9H8ClN3S and a molecular weight of 225.70 g/mol. IUPAC name: 3-(4-chlorophenyl)-4-methyl-1H-1,2,4-triazole-5-thione. InChIKey: HAWRMYDVPCGDJW-UHFFFAOYSA-N.
| Molecular formula | C9H8ClN3S |
|---|---|
| Molecular weight | 225.70 g/mol |
| IUPAC name | 3-(4-chlorophenyl)-4-methyl-1H-1,2,4-triazole-5-thione |
| InChIKey | HAWRMYDVPCGDJW-UHFFFAOYSA-N |
| SMILES | CN1C(=NNC1=S)C2=CC=C(C=C2)Cl |
Computed by PubChem (NCBI)