Products 29527-27-3

CAS 29527-27-3 is the registry number for 5-(4-Chlorophenyl)-4-methyl-4h-1,2,4-triazole-3-thiol, 95%. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 1g, 5g, 10g, 250mg.

Structural formula: {0} (CAS {1})

3-(4-chlorophenyl)-4-methyl-1H-1,2,4-triazole-5-thione (CAS 29527-27-3) is a chemical compound with the molecular formula C9H8ClN3S and a molecular weight of 225.70 g/mol. IUPAC name: 3-(4-chlorophenyl)-4-methyl-1H-1,2,4-triazole-5-thione. InChIKey: HAWRMYDVPCGDJW-UHFFFAOYSA-N.

Identity
Molecular formulaC9H8ClN3S
Molecular weight225.70 g/mol
IUPAC name3-(4-chlorophenyl)-4-methyl-1H-1,2,4-triazole-5-thione
InChIKeyHAWRMYDVPCGDJW-UHFFFAOYSA-N
SMILESCN1C(=NNC1=S)C2=CC=C(C=C2)Cl

Computed by PubChem (NCBI)