Products 667412-57-9
CAS 667412-57-9 appears in our catalog under these names: 4-(3-Chloro-4-methylphenyl)-4h-1,2,4-triazole-3-thiol, 95%, 4-(3-Chloro-4-methylphenyl)-4H-1,2,4-triazole-3-thiol. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 10g, 250mg, 1g, 100mg, 0,5g.
4-(3-chloro-4-methylphenyl)-1H-1,2,4-triazole-5-thione (CAS 667412-57-9) is a chemical compound with the molecular formula C9H8ClN3S and a molecular weight of 225.70 g/mol. IUPAC name: 4-(3-chloro-4-methylphenyl)-1H-1,2,4-triazole-5-thione. InChIKey: KHQUDUXSVOKFOK-UHFFFAOYSA-N.
| Molecular formula | C9H8ClN3S |
|---|---|
| Molecular weight | 225.70 g/mol |
| IUPAC name | 4-(3-chloro-4-methylphenyl)-1H-1,2,4-triazole-5-thione |
| InChIKey | KHQUDUXSVOKFOK-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)N2C=NNC2=S)Cl |
Computed by PubChem (NCBI)