cas: 85604-06-4 — see every product listed under this CAS number, including other names
5-(Benzyloxy)-2-bromobenzaldehyde 97% (CAS 85604-06-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A125341-250mg |
| cas | 85604-06-4 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 197.94 Pln | |
| Ambeed | 1g | 220.19 Pln | |
| Ambeed | 5g | 253.56 Pln | |
| Ambeed | 25g | 537.25 Pln | |
| Ambeed | 100g | 1560.75 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A125341 |
2-bromo-5-phenylmethoxybenzaldehyde (CAS 85604-06-4) is a chemical compound with the molecular formula C14H11BrO2 and a molecular weight of 291.14 g/mol. IUPAC name: 2-bromo-5-phenylmethoxybenzaldehyde. InChIKey: NUBOCIQJROMWLP-UHFFFAOYSA-N.
| Molecular formula | C14H11BrO2 |
|---|---|
| Molecular weight | 291.14 g/mol |
| IUPAC name | 2-bromo-5-phenylmethoxybenzaldehyde |
| InChIKey | NUBOCIQJROMWLP-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=CC(=C(C=C2)Br)C=O |
Computed by PubChem (NCBI)