cas: 1186663-48-8 — see every product listed under this CAS number, including other names
5-(Methylsulfonyl)picolinic acid 97% (CAS 1186663-48-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A135320-100mg |
| cas | 1186663-48-8 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 203.50 Pln | |
| Ambeed | 250mg | 225.75 Pln | |
| Ambeed | 1g | 331.44 Pln | |
| Ambeed | 5g | 1193.62 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A135320 |
5-methylsulfonylpyridine-2-carboxylic acid (CAS 1186663-48-8) is a chemical compound with the molecular formula C7H7NO4S and a molecular weight of 201.20 g/mol. IUPAC name: 5-methylsulfonylpyridine-2-carboxylic acid. InChIKey: UYAWBLWKUAJDRG-UHFFFAOYSA-N.
| Molecular formula | C7H7NO4S |
|---|---|
| Molecular weight | 201.20 g/mol |
| IUPAC name | 5-methylsulfonylpyridine-2-carboxylic acid |
| InChIKey | UYAWBLWKUAJDRG-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)C1=CN=C(C=C1)C(=O)O |
Computed by PubChem (NCBI)