Products 632-24-6
CAS 632-24-6 appears in our catalog under these names: 2-Carboxy phenylsulfamide, 96%, 2-(Aminosulfonyl)benzoic Acid, 2–(Sulfamoylamino)benzoic acid, 2-Sulfamoylbenzoic acid 97%, 2-(Aminosulfonyl)benzoic acid, 97%, 97%. Offered by: Combi-blocks, TRC, GLPBio, Biosynth, Ambeed. Available pack sizes: 250mg, 1g, 5g, 100mg, 25mg, 5mg, 50mg, 500mg.
2-sulfamoylbenzoic acid (CAS 632-24-6) is a chemical compound with the molecular formula C7H7NO4S and a molecular weight of 201.20 g/mol. IUPAC name: 2-sulfamoylbenzoic acid. InChIKey: KDNIOKSLVIGAAN-UHFFFAOYSA-N.
| Molecular formula | C7H7NO4S |
|---|---|
| Molecular weight | 201.20 g/mol |
| IUPAC name | 2-sulfamoylbenzoic acid |
| InChIKey | KDNIOKSLVIGAAN-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(=O)O)S(=O)(=O)N |
Computed by PubChem (NCBI)