5-(Methylsulfonyl)picolinic acid, 98%
cas: 1186663-48-8 — see every product listed under this CAS number, including other names
5-(Methylsulfonyl)picolinic acid, 98% (CAS 1186663-48-8) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F446574-250MG |
| cas | 1186663-48-8 |
| size | 250mg |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 195.78 Pln | |
| Fluorochem | 1g | 362.39 Pln | |
| Fluorochem | 5g | 1320.39 Pln | |
| Fluorochem | 10g | 2575.15 Pln | |
| Fluorochem | 25g | 6355.07 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
5-methylsulfonylpyridine-2-carboxylic acid (CAS 1186663-48-8) is a chemical compound with the molecular formula C7H7NO4S and a molecular weight of 201.20 g/mol. IUPAC name: 5-methylsulfonylpyridine-2-carboxylic acid. InChIKey: UYAWBLWKUAJDRG-UHFFFAOYSA-N.
| Molecular formula | C7H7NO4S |
|---|---|
| Molecular weight | 201.20 g/mol |
| IUPAC name | 5-methylsulfonylpyridine-2-carboxylic acid |
| InChIKey | UYAWBLWKUAJDRG-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)C1=CN=C(C=C1)C(=O)O |
Computed by PubChem (NCBI)