cas: 5066-94-4 — see every product listed under this CAS number, including other names
5-(Sec-butyl)-3-phenyl-2-thioxoimidazolidin-4-one (CAS 5066-94-4) is a chemical reagent available from Chemat. Available pack sizes: 25mg, 100mg, 500mg. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F756928-25MG |
| cas | 5066-94-4 |
| size | 25mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 25mg | 315.53 Pln | |
| Fluorochem | 100mg | 674.78 Pln | |
| Fluorochem | 500mg | 2252.35 Pln |
| delivery time | 3-4 weeks |
|---|
5-butan-2-yl-3-phenyl-2-sulfanylideneimidazolidin-4-one (CAS 5066-94-4) is a chemical compound with the molecular formula C13H16N2OS and a molecular weight of 248.35 g/mol. IUPAC name: 5-butan-2-yl-3-phenyl-2-sulfanylideneimidazolidin-4-one. InChIKey: NMRFWXLNHGJLIU-UHFFFAOYSA-N.
| Molecular formula | C13H16N2OS |
|---|---|
| Molecular weight | 248.35 g/mol |
| IUPAC name | 5-butan-2-yl-3-phenyl-2-sulfanylideneimidazolidin-4-one |
| InChIKey | NMRFWXLNHGJLIU-UHFFFAOYSA-N |
| SMILES | CCC(C)C1C(=O)N(C(=S)N1)C2=CC=CC=C2 |
Computed by PubChem (NCBI)