CAS 1008997-17-8 appears in our catalog under these names: 5-Isopropyl-3-(4-methylphenyl)-2-thioxoimidazolidin-4-one, 95%, 3-(4-Methylphenyl)-5-(propan-2-yl)-2-sulfanylideneimidazolidin-4-one, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 10g, 250mg, 1g, 100mg.
3-(4-methylphenyl)-5-propan-2-yl-2-sulfanylideneimidazolidin-4-one (CAS 1008997-17-8) is a chemical compound with the molecular formula C13H16N2OS and a molecular weight of 248.35 g/mol. IUPAC name: 3-(4-methylphenyl)-5-propan-2-yl-2-sulfanylideneimidazolidin-4-one. InChIKey: URLRESQYWGFJPO-UHFFFAOYSA-N.
| Molecular formula | C13H16N2OS |
|---|---|
| Molecular weight | 248.35 g/mol |
| IUPAC name | 3-(4-methylphenyl)-5-propan-2-yl-2-sulfanylideneimidazolidin-4-one |
| InChIKey | URLRESQYWGFJPO-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)N2C(=O)C(NC2=S)C(C)C |
Computed by PubChem (NCBI)