CAS 879053-84-6 is the registry number for 4-(4-Methoxy-2,5-dimethylphenyl)-5-methyl-1,3-thiazol-2-amine, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g.
4-(4-methoxy-2,5-dimethylphenyl)-5-methyl-1,3-thiazol-2-amine (CAS 879053-84-6) is a chemical compound with the molecular formula C13H16N2OS and a molecular weight of 248.35 g/mol. IUPAC name: 4-(4-methoxy-2,5-dimethylphenyl)-5-methyl-1,3-thiazol-2-amine. InChIKey: GWWRAZUSAFMTCM-UHFFFAOYSA-N.
| Molecular formula | C13H16N2OS |
|---|---|
| Molecular weight | 248.35 g/mol |
| IUPAC name | 4-(4-methoxy-2,5-dimethylphenyl)-5-methyl-1,3-thiazol-2-amine |
| InChIKey | GWWRAZUSAFMTCM-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1OC)C)C2=C(SC(=N2)N)C |
Computed by PubChem (NCBI)