cas: 131395-27-2 — see every product listed under this CAS number, including other names
5-(Trifluoromethoxy)-[1,1'-biphenyl]-2-amine, ≥95%, ≥95% (CAS 131395-27-2) is a chemical reagent available from Chemat. Available pack sizes: 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12DNL9-1g |
| cas | 131395-27-2 |
| size | 1g |
| availability | 23g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 3693.20 Pln |
| purity | ≥95% |
|---|---|
| delivery time | 3 weeks |
2-phenyl-4-(trifluoromethoxy)aniline (CAS 131395-27-2) is a chemical compound with the molecular formula C13H10F3NO and a molecular weight of 253.22 g/mol. IUPAC name: 2-phenyl-4-(trifluoromethoxy)aniline. InChIKey: DNSUFAAFDZLIJJ-UHFFFAOYSA-N.
| Molecular formula | C13H10F3NO |
|---|---|
| Molecular weight | 253.22 g/mol |
| IUPAC name | 2-phenyl-4-(trifluoromethoxy)aniline |
| InChIKey | DNSUFAAFDZLIJJ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=C(C=CC(=C2)OC(F)(F)F)N |
Computed by PubChem (NCBI)