cas: 105391-76-2 — see every product listed under this CAS number, including other names
5-(Trifluoromethoxy)-1H-indazole, 97%, 97% (CAS 105391-76-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1106EQ-100mg |
| cas | 105391-76-2 |
| size | 100mg |
| availability | 15g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 270.80 Pln | |
| Chemat | 250mg | 333.20 Pln | |
| Chemat | 1g | 530.00 Pln | |
| Chemat | 5g | 1782.80 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
5-(trifluoromethoxy)-1H-indazole (CAS 105391-76-2) is a chemical compound with the molecular formula C8H5F3N2O and a molecular weight of 202.13 g/mol. IUPAC name: 5-(trifluoromethoxy)-1H-indazole. InChIKey: UTJHKIRGHNBXRL-UHFFFAOYSA-N.
| Molecular formula | C8H5F3N2O |
|---|---|
| Molecular weight | 202.13 g/mol |
| IUPAC name | 5-(trifluoromethoxy)-1H-indazole |
| InChIKey | UTJHKIRGHNBXRL-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1OC(F)(F)F)C=NN2 |
Computed by PubChem (NCBI)