cas: 868271-14-1 — see every product listed under this CAS number, including other names
5-(Trifluoromethyl)benzo[d]isoxazol-3-amine, 98%, 98% (CAS 868271-14-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11IE91-100mg |
| cas | 868271-14-1 |
| size | 100mg |
| availability | 3g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 203.60 Pln | |
| Chemat | 250mg | 304.40 Pln | |
| Chemat | 1g | 784.40 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
N,N,3-trimethyl-1-benzofuran-2-carboxamide (CAS 868271-14-1) is a chemical compound with the molecular formula C12H13NO2 and a molecular weight of 203.24 g/mol. IUPAC name: N,N,3-trimethyl-1-benzofuran-2-carboxamide. InChIKey: KTCSLSTYOZSYLF-UHFFFAOYSA-N.
| Molecular formula | C12H13NO2 |
|---|---|
| Molecular weight | 203.24 g/mol |
| IUPAC name | N,N,3-trimethyl-1-benzofuran-2-carboxamide |
| InChIKey | KTCSLSTYOZSYLF-UHFFFAOYSA-N |
| SMILES | CC1=C(OC2=CC=CC=C12)C(=O)N(C)C |
Computed by PubChem (NCBI)