5-(tert-Butyl)-[1,1'-biphenyl]-2-amine, 97%
cas: 1410783-24-2 — see every product listed under this CAS number, including other names
5-(tert-Butyl)-[1,1'-biphenyl]-2-amine, 97% (CAS 1410783-24-2) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g, 100g, 10g, 50g. Offered by: Fluorochem, Ambeed, Chemat, BLDpharm.
| brand | Fluorochem |
|---|---|
| catalog number | F865110-1G |
| cas | 1410783-24-2 |
| size | 1g |
| availability | In Stock China |
Documents:
Safety Data Sheet (MSDS)
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 174.96 Pln | |
| Fluorochem | 5g | 435.28 Pln | |
| Fluorochem | 25g | 1268.32 Pln | |
| Fluorochem | 100g | 3278.03 Pln | |
| Ambeed | 1g | 220.19 Pln | |
| Ambeed | 5g | 570.62 Pln | |
| Ambeed | 25g | 1738.75 Pln | |
| Ambeed | 100g | 6149.81 Pln | |
| Chemat | 1g | 117.20 Pln | |
| Chemat | 5g | 266.00 Pln | |
| Chemat | 10g | 400.40 Pln | |
| Chemat | 25g | 741.20 Pln | |
| Chemat | 50g | 1192.40 Pln | |
| BLDpharm | 1g | 231.05 Pln | |
| BLDpharm | 5g | 614.25 Pln | |
| BLDpharm | 25g | 1869.37 Pln | |
| BLDpharm | 100g | 6623.25 Pln |
properties
| purity | 97% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 2-3 weeks |
| category | Odczynniki chemiczne |
4-tert-butyl-2-phenylaniline (CAS 1410783-24-2) is a chemical compound with the molecular formula C16H19N and a molecular weight of 225.33 g/mol. IUPAC name: 4-tert-butyl-2-phenylaniline. InChIKey: BAGPVLYGSZKWDX-UHFFFAOYSA-N.
| Molecular formula | C16H19N |
|---|---|
| Molecular weight | 225.33 g/mol |
| IUPAC name | 4-tert-butyl-2-phenylaniline |
| InChIKey | BAGPVLYGSZKWDX-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC(=C(C=C1)N)C2=CC=CC=C2 |
Computed by PubChem (NCBI)