CAS 55389-75-8 appears in our catalog under these names: Bis-(3,4-dimethyl-phenyl)-amine, 97%, Bis(3,4-dimethylphenyl)amineBis(3,4-dimethylphenyl)amine, >98% (HPLC), Bis(3,4–dimethylphenyl)amine, Bis(3,4-dimethylphenyl)amine, >97.0%(GC), Bis-(3,4-dimethylphenyl)amine 97%. Offered by: Combi-blocks, Lumtec, GLPBio, TCI, Ambeed. Available pack sizes: 5g, 1g, On request, 100mg, 250mg, 25g, 10g, 50g.
N-(3,4-dimethylphenyl)-3,4-dimethylaniline (CAS 55389-75-8) is a chemical compound with the molecular formula C16H19N and a molecular weight of 225.33 g/mol. IUPAC name: N-(3,4-dimethylphenyl)-3,4-dimethylaniline. InChIKey: IMQQPEKHINRTCE-UHFFFAOYSA-N.
| Molecular formula | C16H19N |
|---|---|
| Molecular weight | 225.33 g/mol |
| IUPAC name | N-(3,4-dimethylphenyl)-3,4-dimethylaniline |
| InChIKey | IMQQPEKHINRTCE-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)NC2=CC(=C(C=C2)C)C)C |
Computed by PubChem (NCBI)