CAS 21003-56-5 is the registry number for (+)-Bis[(r)-1-phenylethyl]amine, 97%. Offered by: Combi-blocks. Available pack sizes: 10g, 1g, 25g, 5g.
(1S)-1-phenyl-N-[(1S)-1-phenylethyl]ethanamine (CAS 21003-56-5) is a chemical compound with the molecular formula C16H19N and a molecular weight of 225.33 g/mol. IUPAC name: (1S)-1-phenyl-N-[(1S)-1-phenylethyl]ethanamine. InChIKey: NXLACVVNHYIYJN-KBPBESRZSA-N.
| Molecular formula | C16H19N |
|---|---|
| Molecular weight | 225.33 g/mol |
| IUPAC name | (1S)-1-phenyl-N-[(1S)-1-phenylethyl]ethanamine |
| InChIKey | NXLACVVNHYIYJN-KBPBESRZSA-N |
| SMILES | C[C@@H](C1=CC=CC=C1)N[C@@H](C)C2=CC=CC=C2 |
Computed by PubChem (NCBI)