CAS 4600-86-6 appears in our catalog under these names: 5–(tert–Butyl)–2,3–dihydro–1H–inden–1–one, 5-(tert-Butyl)-2,3-dihydro-1H-inden-1-one, 97%, 97%, 5-tert-Butyl-1-indanone, 98%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 25g, 10g, 50g, 100g.
5-tert-butyl-2,3-dihydroinden-1-one (CAS 4600-86-6) is a chemical compound with the molecular formula C13H16O and a molecular weight of 188.26 g/mol. IUPAC name: 5-tert-butyl-2,3-dihydroinden-1-one. InChIKey: IIJPVOVAVTZFRH-UHFFFAOYSA-N.
| Molecular formula | C13H16O |
|---|---|
| Molecular weight | 188.26 g/mol |
| IUPAC name | 5-tert-butyl-2,3-dihydroinden-1-one |
| InChIKey | IIJPVOVAVTZFRH-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC2=C(C=C1)C(=O)CC2 |
Computed by PubChem (NCBI)