CAS 153759-59-2 appears in our catalog under these names: 5–(tert–butyl)–4–hydroxyisophthalaldehyde, 5-(Tert-butyl)-4-hydroxyisophthalaldehyde, 98%, 98%, 5-tert-Butyl-4-hydroxybenzene-1,3-dicarbaldehyde, 97%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 1g, 500mg, 100mg, 250mg, 5g.
5-tert-butyl-4-hydroxybenzene-1,3-dicarbaldehyde (CAS 153759-59-2) is a chemical compound with the molecular formula C12H14O3 and a molecular weight of 206.24 g/mol. IUPAC name: 5-tert-butyl-4-hydroxybenzene-1,3-dicarbaldehyde. InChIKey: LGWDKUHSQODBHL-UHFFFAOYSA-N.
| Molecular formula | C12H14O3 |
|---|---|
| Molecular weight | 206.24 g/mol |
| IUPAC name | 5-tert-butyl-4-hydroxybenzene-1,3-dicarbaldehyde |
| InChIKey | LGWDKUHSQODBHL-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC(=CC(=C1O)C=O)C=O |
Computed by PubChem (NCBI)