CAS 53146-48-8 appears in our catalog under these names: 5–(tert–Butyl)benzo(d)oxazole–2–thiol, 5-(tert-Butyl)benzo[d]oxazole-2-thiol, 97%, 97%, 5-tert-butyl-1,3-benzoxazole-2-thiol, 98%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 25g, 10g.
5-tert-butyl-3H-1,3-benzoxazole-2-thione (CAS 53146-48-8) is a chemical compound with the molecular formula C11H13NOS and a molecular weight of 207.29 g/mol. IUPAC name: 5-tert-butyl-3H-1,3-benzoxazole-2-thione. InChIKey: OIOGHWZPVMHTEA-UHFFFAOYSA-N.
| Molecular formula | C11H13NOS |
|---|---|
| Molecular weight | 207.29 g/mol |
| IUPAC name | 5-tert-butyl-3H-1,3-benzoxazole-2-thione |
| InChIKey | OIOGHWZPVMHTEA-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC2=C(C=C1)OC(=S)N2 |
Computed by PubChem (NCBI)