CAS 2411954-63-5 is the registry number for Bicyclo[1.1.1]pentan-1-yl(imino)(phenyl)-l6-sulfanone, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
1-bicyclo[1.1.1]pentanyl-imino-oxo-phenyl-lambda6-sulfane (CAS 2411954-63-5) is a chemical compound with the molecular formula C11H13NOS and a molecular weight of 207.29 g/mol. IUPAC name: 1-bicyclo[1.1.1]pentanyl-imino-oxo-phenyl-lambda6-sulfane. InChIKey: NEKGDCIKXKJMQB-UHFFFAOYSA-N.
| Molecular formula | C11H13NOS |
|---|---|
| Molecular weight | 207.29 g/mol |
| IUPAC name | 1-bicyclo[1.1.1]pentanyl-imino-oxo-phenyl-lambda6-sulfane |
| InChIKey | NEKGDCIKXKJMQB-UHFFFAOYSA-N |
| SMILES | C1C2CC1(C2)S(=N)(=O)C3=CC=CC=C3 |
Computed by PubChem (NCBI)