CAS 2789682-25-1 is the registry number for 5',6'-Dihydro-4'H-spiro[cyclopentane-1,7'-thieno[3,2-c]pyridin]-4'-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Spiro[5,6-dihydrothieno[3,2-c]pyridine-7,1'-cyclopentane]-4-one (CAS 2789682-25-1) is a chemical compound with the molecular formula C11H13NOS and a molecular weight of 207.29 g/mol. IUPAC name: spiro[5,6-dihydrothieno[3,2-c]pyridine-7,1'-cyclopentane]-4-one. InChIKey: AWQUIPLFYYZFOY-UHFFFAOYSA-N.
| Molecular formula | C11H13NOS |
|---|---|
| Molecular weight | 207.29 g/mol |
| IUPAC name | spiro[5,6-dihydrothieno[3,2-c]pyridine-7,1'-cyclopentane]-4-one |
| InChIKey | AWQUIPLFYYZFOY-UHFFFAOYSA-N |
| SMILES | C1CCC2(C1)CNC(=O)C3=C2SC=C3 |
Computed by PubChem (NCBI)