cas: 1155997-93-5 — see every product listed under this CAS number, including other names
5-[(3-FLUOROPHENYL)METHYL]-4-METHYL-1,3-THIAZOL-2-AMINE, 95% (CAS 1155997-93-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat, Fluorochem.
| brand | Chemat |
|---|---|
| catalog number | Ch120VHZ-100mg |
| cas | 1155997-93-5 |
| size | 100mg |
| availability | 10g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 750.80 Pln | |
| Chemat | 250mg | 1096.40 Pln | |
| Chemat | 1g | 2128.40 Pln | |
| Chemat | 5g | 6266.00 Pln | |
| Fluorochem | 100mg | 1393.28 Pln | |
| Fluorochem | 250mg | 2028.47 Pln | |
| Fluorochem | 1g | 3934.05 Pln | |
| Fluorochem | 5g | 11426.20 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
5-[(3-fluorophenyl)methyl]-4-methyl-1,3-thiazol-2-amine (CAS 1155997-93-5) is a chemical compound with the molecular formula C11H11FN2S and a molecular weight of 222.28 g/mol. IUPAC name: 5-[(3-fluorophenyl)methyl]-4-methyl-1,3-thiazol-2-amine. InChIKey: YXCGPFIAEVMHEW-UHFFFAOYSA-N.
| Molecular formula | C11H11FN2S |
|---|---|
| Molecular weight | 222.28 g/mol |
| IUPAC name | 5-[(3-fluorophenyl)methyl]-4-methyl-1,3-thiazol-2-amine |
| InChIKey | YXCGPFIAEVMHEW-UHFFFAOYSA-N |
| SMILES | CC1=C(SC(=N1)N)CC2=CC(=CC=C2)F |
Computed by PubChem (NCBI)