CAS 1155997-93-5 is the registry number for 5-((3-Fluorophenyl)methyl)-4-methyl-1,3-thiazol-2-amine, 95%. Offered by: AmBeed. Available pack sizes: 5g.
5-[(3-fluorophenyl)methyl]-4-methyl-1,3-thiazol-2-amine (CAS 1155997-93-5) is a chemical compound with the molecular formula C11H11FN2S and a molecular weight of 222.28 g/mol. IUPAC name: 5-[(3-fluorophenyl)methyl]-4-methyl-1,3-thiazol-2-amine. InChIKey: YXCGPFIAEVMHEW-UHFFFAOYSA-N.
| Molecular formula | C11H11FN2S |
|---|---|
| Molecular weight | 222.28 g/mol |
| IUPAC name | 5-[(3-fluorophenyl)methyl]-4-methyl-1,3-thiazol-2-amine |
| InChIKey | YXCGPFIAEVMHEW-UHFFFAOYSA-N |
| SMILES | CC1=C(SC(=N1)N)CC2=CC(=CC=C2)F |
Computed by PubChem (NCBI)