CAS 1155998-70-1 appears in our catalog under these names: 5-(4-Fluorobenzyl)-4-methylthiazol-2-amine, 97%, 5-((4-Fluorophenyl)methyl)-4-methyl-1,3-thiazol-2-amine. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 0,5g, 50mg.
5-[(4-fluorophenyl)methyl]-4-methyl-1,3-thiazol-2-amine (CAS 1155998-70-1) is a chemical compound with the molecular formula C11H11FN2S and a molecular weight of 222.28 g/mol. IUPAC name: 5-[(4-fluorophenyl)methyl]-4-methyl-1,3-thiazol-2-amine. InChIKey: WVDURYWVTONNHM-UHFFFAOYSA-N.
| Molecular formula | C11H11FN2S |
|---|---|
| Molecular weight | 222.28 g/mol |
| IUPAC name | 5-[(4-fluorophenyl)methyl]-4-methyl-1,3-thiazol-2-amine |
| InChIKey | WVDURYWVTONNHM-UHFFFAOYSA-N |
| SMILES | CC1=C(SC(=N1)N)CC2=CC=C(C=C2)F |
Computed by PubChem (NCBI)